A1403712
5-Bromo-4-chloroindoxyl 1,3-diacetate , ≥97.0% , 3030-06-6
Synonym(s):
5-Bromo-4-chloro-3-indolyl 1,3-diacetate
CAS NO.:3030-06-6
Empirical Formula: C12H9BrClNO3
Molecular Weight: 330.56
MDL number: MFCD00040632
EINECS: 221-200-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB105.60 | In Stock |
|
| 1G | RMB200.00 | In Stock |
|
| 5G | RMB603.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-168 °C (lit.) |
| Boiling point: | 429.5±40.0 °C(Predicted) |
| Density | 1+-.0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol |
| form | Powder |
| color | Pale Yellow to Dark Yellow |
| BRN | 270885 |
| Stability: | Moisture, Temperature, Light sensitive |
| InChI | InChI=1S/C12H9BrClNO3/c1-6(16)15-5-10(18-7(2)17)11-9(15)4-3-8(13)12(11)14/h3-5H,1-2H3 |
| InChIKey | DSHQTSIXXYZXGR-UHFFFAOYSA-N |
| SMILES | C(=O)(N1C2=C(C(Cl)=C(Br)C=C2)C(OC(C)=O)=C1)C |
| CAS DataBase Reference | 3030-06-6(CAS DataBase Reference) |
Description and Uses
5-Bromo-4-chloroindoxyl 1,3-diacetate was used as starting reagent in the synthesis of 5,5′-dibromo-4,4′-dichloroindigo.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |




