A1403812
5-Bromoisatin , ≥96.0% , 87-48-9
CAS NO.：87-48-9
Empirical Formula: C8H4BrNO2
Molecular Weight: 226.03
MDL number: MFCD00005719
EINECS: 201-747-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB316.00 | In Stock |
|
| 500G | RMB1480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-252 °C (lit.) |
| Density | 1.7498 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in N,N dimethylformamide. |
| pka | 8.74±0.20(Predicted) |
| form | Crystalline Powder |
| color | Orange |
| BRN | 383760 |
| InChI | InChI=1S/C8H4BrNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | MBVCESWADCIXJN-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 87-48-9(CAS DataBase Reference) |
Description and Uses
5-Bromoisatin is used in the synthesis of N-derivatives of 5-bromoisatin, N-substituted pyrroles, linear polyaryleneoxindoles, 5-bromodioxindole, cinchoninic acid derivatives, 3-hydroxyoxindole, S-benzyldithiocarbazate Schiff Bases, 5-bromooxindole and Morita-Baylis-Hillman adducts of isatin derivatives. It is an indole derivative.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/39-37/39-36 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| RTECS | NL7875000 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
