A1404512
Benfotiamine , 98.0% , 22457-89-2
Synonym(s):
Benfotiamine
CAS NO.:22457-89-2
Empirical Formula: C19H23N4O6PS
Molecular Weight: 466.45
MDL number: MFCD00057343
EINECS: 245-013-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB147.20 | In Stock |
|
| 25G | RMB411.20 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 C |
| Boiling point: | 745.1±70.0 °C(Predicted) |
| Density | 1.444±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Aqueous Acid (Slightly), DMSO (Heated, Sonicated) |
| form | Solid |
| pka | 1.84±0.10(Predicted) |
| color | White to Off-White |
| Merck | 14,1041 |
| Stability: | Hygroscopic |
| InChIKey | BTNNPSLJPBRMLZ-GHRIWEEISA-N |
| SMILES | C(C1=CN=C(C)N=C1N)N(C=O)C(C)=C(CCOP(O)(O)=O)SC(C1C=CC=CC=1)=O |
| LogP | -2.814 (est) |
| CAS DataBase Reference | 22457-89-2(CAS DataBase Reference) |
Description and Uses
S-Benzoylthiamine O-monophosphate has been used to determine its effect on ischemia and reperfusion in skeletal muscles of rat.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DH6910000 |
| HS Code | 2933.59.8000 |




