A1413012
Brompheniramine hydrogen maleate , ≥98% , 980-71-2
Synonym(s):
(±)-Brompheniramine maleate salt
CAS NO.:980-71-2
Empirical Formula: C20H23BrN2O4
Molecular Weight: 435.31
MDL number: MFCD00057367
EINECS: 213-562-9
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB31.20 | In Stock |
|
| 250MG | RMB55.20 | In Stock |
|
| 1g | RMB67.20 | In Stock |
|
| 5g | RMB141.60 | In Stock |
|
| 25g | RMB375.20 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-135°C |
| Flash point: | 9℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in water, freely soluble in ethanol (96 per cent), in methanol and in methylene chloride. |
| form | Solid |
| color | White to Off-White |
| λmax | 261nm(lit.) |
| Merck | 14,1443 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C16H19BrN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SRGKFVAASLQVBO-BTJKTKAUSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(C1=NC=CC=C1)CCN(C)C.C(O)(=O)/C=C\C(O)=O |
| LogP | 3.565 (est) |
| CAS DataBase Reference | 980-71-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Pyridinepropanamine, .gamma.-(4-bromophenyl)-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) (980-71-2) |
Description and Uses
Brompheniramine is a first generation antihistamine of the propylamine class. It antagonizes histamine H1 receptors (Ki = 6.06 nM) and also inhibits the reuptake of serotonin and norepinephrine.
An antihistamine and also an inhibitor of serotonin reuptake
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn,Xi,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36-45-36/37-16-7 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | US4025000 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 38220090 |





