A1414212
Bisacodyl , ≥98% , 603-50-9
Synonym(s):
4,4′-(2-pyridylmethylene)-bisphenol diacetate;Bisacodyl
CAS NO.:603-50-9
Empirical Formula: C22H19NO4
Molecular Weight: 361.39
MDL number: MFCD00038039
EINECS: 210-044-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB228.00 | In Stock |
|
| 100g | RMB787.20 | In Stock |
|
| 500g | RMB3840.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138°C |
| Boiling point: | 493.21°C (rough estimate) |
| Density | 1.2545 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Practically insoluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent). It dissolves in dilute mineral acids. |
| pka | 4.69±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in alcohol (slightly), ether (slightly), chloroform, and acetone. Insoluble in water. |
| λmax | 220nm(MeOH)(lit.) |
| Merck | 14,1242 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C22H19NO4/c1-15(24)26-19-10-6-17(7-11-19)22(21-5-3-4-14-23-21)18-8-12-20(13-9-18)27-16(2)25/h3-14,22H,1-2H3 |
| InChIKey | KHOITXIGCFIULA-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(cc1)C(c2ccc(OC(C)=O)cc2)c3ccccn3 |
| LogP | 3.453 (est) |
| CAS DataBase Reference | 603-50-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Bisacodyl(603-50-9) |
| EPA Substance Registry System | Phenol, 4,4'-(2-pyridinylmethylene)bis-, diacetate (ester) (603-50-9) |
Description and Uses
Stimulant laxative.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | SM8750000 |
| TSCA | TSCA listed |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 603-50-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >3 g/kg (Schmidt) |





