A1426112
Boc-D-β-Phe-OH , ≥98.0%(HPLC) , 103365-47-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB204.80 | In Stock |
|
| 1G | RMB664.00 | In Stock |
|
| 5G | RMB2703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122.9 °C |
| Boiling point: | 408.52°C (rough estimate) |
| Density | 1.1356 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | 2-8°C |
| pka | 4.32±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(9-12(16)17)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | JTNQFJPZRTURSI-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)c1ccccc1 |
| CAS DataBase Reference | 103365-47-5(CAS DataBase Reference) |
Description and Uses
(S)-3-Phenyl-3-(tert-butoxycarbonylamino)propanoic Acid, is an unnatural amino acid derivative. It can be used for the synthesis of Carnosine (C184190), derivatives as selective and efficient sequestering agents of cytotoxic reactive carbonyl species.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |




