PRODUCT Properties
| Melting point: | 278-280?C |
| Boiling point: | 393.8±42.0 °C(Predicted) |
| Density | 1.620±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO |
| form | Solid |
| pka | 10.76±0.70(Predicted) |
| color | Beige |
| InChI | InChI=1S/C9H6BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5H,(H,11,12) |
| InChIKey | YLAFBGATSQRSTB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C=CC1=O |
Description and Uses
6-Bromo-2(1H)-quinolinone is a useful intermediate for the synthesis of other quinoline derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







![6-Bromo-3-methyl-3H-naphtho[1,2,3-de]quinoline-2,7-dione](https://img.chemicalbook.com/CAS/GIF/81-85-6.gif)
