PRODUCT Properties
Melting point: | 278-280?C |
Boiling point: | 393.8±42.0 °C(Predicted) |
Density | 1.620±0.06 g/cm3(Predicted) |
storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
solubility | DMSO |
form | Solid |
pka | 10.76±0.70(Predicted) |
color | Beige |
InChI | InChI=1S/C9H6BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5H,(H,11,12) |
InChIKey | YLAFBGATSQRSTB-UHFFFAOYSA-N |
SMILES | N1C2=C(C=C(Br)C=C2)C=CC1=O |
Description and Uses
6-Bromo-2(1H)-quinolinone is a useful intermediate for the synthesis of other quinoline derivatives.
Safety
Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
Signal word | Danger |
Hazard statements | H302-H318 |
Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
Hazard Codes | Xn |
Risk Statements | 22-41 |
Safety Statements | 26-39 |
WGK Germany | 3 |
HS Code | 2933499090 |