A1430912
1-(tert-Butoxycarbonyl)-3-azetidinemethanol , 95% , 142253-56-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB25.60 | In Stock |
|
| 500MG | RMB28.00 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55 °C |
| Boiling point: | 268-273℃ |
| Density | 1.115 |
| Flash point: | 117°(243°F) |
| storage temp. | 2-8°C |
| solubility | Soluble in Dimethyl sulfoxide (DMSO). |
| pka | 14.82±0.10(Predicted) |
| form | powder to lump |
| color | White to Almost white |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-4-7(5-10)6-11/h7,11H,4-6H2,1-3H3 |
| InChIKey | HXRDRJKAEYHOBB-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(CO)C1 |
Description and Uses
1-Boc-Azetidine-3-yl-methanol is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). This compound is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs.
It is an intermediate in organic syntheses
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-26-37-60 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
