A1432512
5-Bromocytosine , 98% , 2240-25-7
Synonym(s):
4-Amino-5-bromo-2-hydroxypyrimidine
CAS NO.:2240-25-7
Empirical Formula: C4H4BrN3O
Molecular Weight: 190
MDL number: MFCD01883049
EINECS: 218-806-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB47.20 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| 25g | RMB815.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-243 °C (dec.) (lit.) |
| Density | 1.7513 (rough estimate) |
| refractive index | 1.6520 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in formic acid (50 mg/ml). |
| form | Solid |
| pka | 7.34±0.10(Predicted) |
| color | White to yellow |
| BRN | 127286 |
| InChI | InChI=1S/C4H4BrN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| InChIKey | QFVKLKDEXOWFSL-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(N)=C(Br)C=N1 |
| NIST Chemistry Reference | 5-Bromocytosine(2240-25-7) |
Description and Uses
5-Bromocytosine was used in the synthesis of five cross-link products- C[5-N6]A, C[5-2]A, C[5-8]A, A[2-5]C, and A[8-5]C, under both aerobic and anaerobic conditions.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-43-48-20/21/22 |
| Safety Statements | 24/25-22-36/37/39-26-45-7/8 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






