A1435612
4-Bromo-3,5-dimethylpyrazole , 99% , 3398-16-1
CAS NO.：3398-16-1
Empirical Formula: C5H7BrN2
Molecular Weight: 175.03
MDL number: MFCD00005242
EINECS: 222-263-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB78.40 | In Stock |
|
| 100G | RMB236.00 | In Stock |
|
| 500g | RMB916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C(lit.) |
| Boiling point: | 269.1±35.0 °C(Predicted) |
| Density | 1.595 |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 13.83±0.50(Predicted) |
| color | White to Light yellow |
| BRN | 108534 |
| InChI | InChI=1S/C5H7BrN2/c1-3-5(6)4(2)8-7-3/h1-2H3,(H,7,8) |
| InChIKey | RISOHYOEPYWKOB-UHFFFAOYSA-N |
| SMILES | N1C(C)=C(Br)C(C)=N1 |
| CAS DataBase Reference | 3398-16-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-3,5-dimethylpyrazole is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | UQ6210000 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Toxicity | LD50 intraperitoneal in mouse: 580mg/kg |
