A1436912
4-Bromoresorcinol , ≥97.0%(GC) , 6626-15-9
CAS NO.：6626-15-9
Empirical Formula: C6H5BrO2
Molecular Weight: 189.01
MDL number: MFCD00002272
EINECS: 229-586-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.96 | In Stock |
|
| 5G | RMB185.60 | In Stock |
|
| 25G | RMB807.20 | In Stock |
|
| 100G | RMB2875.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-100 °C (lit.) |
| Boiling point: | 150 °C/12 mmHg (lit.) |
| Density | 1.5555 (rough estimate) |
| refractive index | 1.4925 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder or Crystals |
| pka | 8.22±0.10(Predicted) |
| color | Pink |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H5BrO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H |
| InChIKey | MPCCNXGZCOXPMG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C(O)=C1 |
| CAS DataBase Reference | 6626-15-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Benzenediol, 4-bromo-(6626-15-9) |
Description and Uses
4-Bromoresorcinol is a reagent for the synthesis of two new series of achiral bent-core mesogens. Also, it is used for the synthesis of a human rhinovirus (HRV) 3C protease inhibitor, pyranonaphthoquinone (-)-thysanone (I).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29089990 |
