A1437712
Boc-β-(2-thienyl)-<SC>D</SC>-Ala-OH , ≥98.0%(HPLC) , 78452-55-8
Synonym(s):
(R)-2-(Boc-amino)-3-(2-thienyl)propionic acid;Boc-3-(2-thienyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 431.5±40.0 °C(Predicted) |
| Density | 1.2791 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| pka | 3.70±0.10(Predicted) |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H17NO4S/c1-12(2,3)17-11(16)13-9(10(14)15)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,13,16)(H,14,15)/t9-/s3 |
| InChIKey | OJLISTAWQHSIHL-DJEYLCQNNA-N |
| SMILES | [C@@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1SC=CC=1 |&1:0,r| |
| CAS DataBase Reference | 78452-55-8(CAS DataBase Reference) |
Description and Uses
(R)-N-Boc-2-Thienylalanine, is an alanine derivative, used in various chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |





![(9H-Fluoren-9-yl)MethOxy]Carbonyl D-2-Chloro-4-fluorophe](https://img.chemicalbook.com/CAS/20180808/GIF/1217680-33-5.gif)

