A1438812
4-Bromo-2,2-diphenylbutyronitrile , 95% , 39186-58-8
CAS NO.：39186-58-8
Empirical Formula: C16H14BrN
Molecular Weight: 300.2
MDL number: MFCD00001845
EINECS: 254-337-5
| Pack Size | Price | Stock | Quantity |
| 10g | RMB40.80 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB188.80 | In Stock |
|
| 500G | RMB735.76 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C(lit.) |
| Boiling point: | 160-165 °C (0.15002 mmHg) |
| Density | 1.4184 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5260 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) Ethyl Acetate (Slightly) |
| form | Solid |
| color | White |
| Water Solubility | 10μg/L at 20℃ |
| BRN | 1684952 |
| InChI | InChI=1S/C16H14BrN/c17-12-11-16(13-18,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10H,11-12H2 |
| InChIKey | IGYSFJHVFHNOEI-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(C#N)CCBr |
| LogP | 4.2 |
| CAS DataBase Reference | 39186-58-8(CAS DataBase Reference) |
Description and Uses
4-BROMO-2,2-DIPHENYLBUTYRONITRILE is a reagent used in the prepration of neurological antagonists.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H302-H312-H331 |
| Precautionary statements | P280h-P304+P340-P311a-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-26-24/25 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
