A1441412
Boc-<I>N</I>-Me-<SC>D</SC>-Leu-OH , ≥98.0% , 89536-84-5
Synonym(s):
Boc-N-methyl-D -leucine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB70.40 | In Stock |
|
| 5G | RMB246.40 | In Stock |
|
| 25G | RMB987.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-65°C |
| Boiling point: | 338.2±21.0 °C(Predicted) |
| Density | 1.053±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 4.04±0.21(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 4184551 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H23NO4/c1-8(2)7-9(10(14)15)13(6)11(16)17-12(3,4)5/h8-9H,7H2,1-6H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | YXJFAOXATCRIKU-SECBINFHSA-N |
| SMILES | CC(C)C[C@@H](N(C)C(=O)OC(C)(C)C)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924190090 |
| Storage Class | 13 - Non Combustible Solids |
