A1442512
1,3-Bis(tosyloxy)propane , ≥98.0%(HPLC) , 5469-66-9
Synonym(s):
Trimethylene glycol di-p-tosylate
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB310.40 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 563.1±38.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C17H20O6S2/c1-14-4-8-16(9-5-14)24(18,19)22-12-3-13-23-25(20,21)17-10-6-15(2)7-11-17/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | ODVREDGIWSDQFD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OCCCOS(=O)(=O)c2ccc(C)cc2 |
| CAS DataBase Reference | 5469-66-9(CAS DataBase Reference) |
Description and Uses
Used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
