Boc-7-Ahp-OH , ≥98.0% , 60142-89-4
Synonym(s):
7-(Boc-amino)enanthic acid;7-(Boc-amino)heptanoic acid;Boc-7-aminoheptanoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB120.80 | In Stock |
|
| 5G | RMB430.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 56-60 °C |
| Boiling point: | 393.1±25.0 °C(Predicted) |
| Density | 1.050±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 4.77±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2050867 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H23NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8-10(14)15/h4-9H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | HJENAZQPOGVAEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCC(O)=O |
| CAS DataBase Reference | 60142-89-4(CAS DataBase Reference) |
Description and Uses
Boc-7-Aminoheptanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applicaitons. Boc-7-Aminoheptanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine.
Boc-7-Aminoheptanoic acid can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. Boc-7-Aminoheptanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| F | 9-21 |
| HS Code | 2922.50.5000 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







