A1446512
3-Bromo-5-methoxytoluene , ≥98.0%(GC) , 29578-83-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52℃ |
| Boiling point: | 228℃ |
| Density | 1.378 |
| refractive index | 1.5560-1.5600 |
| Flash point: | 103℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform |
| form | clear liquid |
| color | Colorless to Light yellow to Red |
| InChI | InChI=1S/C8H9BrO/c1-6-3-7(9)5-8(4-6)10-2/h3-5H,1-2H3 |
| InChIKey | AOEVRCZZWJWKPG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=CC(OC)=C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2909309090 |
