A1446812
Boc-Val-OSu , ≥98% , 3392-12-9
Synonym(s):
Boc-L -valine hydroxysuccinimide ester
CAS NO.:3392-12-9
Empirical Formula: C14H22N2O6
Molecular Weight: 314.33
MDL number: MFCD00037906
EINECS: 222-236-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 100G | RMB560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 °C |
| Density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 10.72±0.46(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D 38±1°, c = 2% in dioxane |
| Sensitive | Moisture Sensitive |
| BRN | 1551859 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H22N2O6/c1-8(2)11(15-13(20)21-14(3,4)5)12(19)22-16-9(17)6-7-10(16)18/h8,11H,6-7H2,1-5H3,(H,15,20)/t11-/m0/s1 |
| InChIKey | POBDBYGSGKMZPH-NSHDSACASA-N |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)ON1C(=O)CCC1=O |
| CAS DataBase Reference | 3392-12-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |






