A1446912
6-Bromoisoquinoline , 97% , 34784-05-9
CAS NO.：34784-05-9
Empirical Formula: C9H6BrN
Molecular Weight: 208.05
MDL number: MFCD04973299
EINECS: 662-848-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB374.40 | In Stock |
|
| 100g | RMB1300.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44.0 to 48.0 °C |
| Boiling point: | 312.3±15.0 °C(Predicted) |
| Density | 1.564±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:8): .5 mg/ml |
| form | Crystalline Powder |
| pka | 4.83±0.10(Predicted) |
| color | White |
| λmax | 320nm(CHCl3)(lit.) |
| InChI | InChI=1S/C9H6BrN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H |
| InChIKey | ZTEATMVVGQUULZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(Br)C=C2)C=CN=1 |
| CAS DataBase Reference | 34784-05-9(CAS DataBase Reference) |
Description and Uses
6-Bromoisoquinoline is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36-20/21/22 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 1 |
| HS Code | 29334900 |
