A1447412
                    Boc-Cit-OH , technical,≥84% , 45234-13-7
                            Synonym(s):
Nα-Boc-L -citrulline
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 5G | RMB278.40 | In Stock | 
                                                 | 
                                        
| 25g | RMB1359.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | ~60 °C | 
                                    
| Boiling point: | 483.0±45.0 °C(Predicted) | 
                                    
| Density | 1.212±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMSO | 
                                    
| pka | 3.95±0.21(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White Foaming | 
                                    
| InChI | InChI=1S/C11H21N3O5/c1-11(2,3)19-10(18)14-7(8(15)16)5-4-6-13-9(12)17/h7H,4-6H2,1-3H3,(H,14,18)(H,15,16)(H3,12,13,17)/t7-/m0/s1 | 
                                    
| InChIKey | CMJCWQISQGNHHI-ZETCQYMHSA-N | 
                                    
| SMILES | C(O)(=O)[C@H](CCCNC(N)=O)NC(OC(C)(C)C)=O | 
                                    
Description and Uses
Boc-L-citrulline is an intermediate in the synthesis of Arginino-succinic Acid Disodium Salt (A769200). Arginino-succinic Acid Sodium Salt is used in the characterization of δ-crystallin in avian species.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| F | 3-10 | 
| HazardClass | IRRITANT | 
| HS Code | 2924297099 | 






