A1447412
Boc-Cit-OH , technical,≥84% , 45234-13-7
Synonym(s):
Nα-Boc-L -citrulline
| Pack Size | Price | Stock | Quantity |
| 5G | RMB278.40 | In Stock |
|
| 25g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~60 °C |
| Boiling point: | 483.0±45.0 °C(Predicted) |
| Density | 1.212±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO |
| pka | 3.95±0.21(Predicted) |
| form | Solid |
| color | White Foaming |
| InChI | InChI=1S/C11H21N3O5/c1-11(2,3)19-10(18)14-7(8(15)16)5-4-6-13-9(12)17/h7H,4-6H2,1-3H3,(H,14,18)(H,15,16)(H3,12,13,17)/t7-/m0/s1 |
| InChIKey | CMJCWQISQGNHHI-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](CCCNC(N)=O)NC(OC(C)(C)C)=O |
Description and Uses
Boc-L-citrulline is an intermediate in the synthesis of Arginino-succinic Acid Disodium Salt (A769200). Arginino-succinic Acid Sodium Salt is used in the characterization of δ-crystallin in avian species.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |






