A1447612
2-Bromo-4-nitropyridine N-oxide , 97% , 52092-43-0
CAS NO.：52092-43-0
Empirical Formula: C5H3BrN2O3
Molecular Weight: 218.99
MDL number: MFCD00160743
EINECS: 661-534-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB112.00 | In Stock |
|
| 5G | RMB472.80 | In Stock |
|
| 25G | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-146°C |
| Boiling point: | 430.2±25.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| pka | -2.53±0.10(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 145698 |
| InChI | InChI=1S/C5H3BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3H |
| InChIKey | IRBDHXCXCSFNEQ-UHFFFAOYSA-N |
| SMILES | C1(Br)[N+]([O-])=CC=C([N+]([O-])=O)C=1 |
| CAS DataBase Reference | 52092-43-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H335-H301-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501-P261-P280a-P301+P310a-P305+P351+P338-P501a |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-26-36/37/39-36 |
| RIDADR | 2811 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
