PRODUCT Properties
| Melting point: | 62 °C |
| Boiling point: | 466.6±28.0 °C(Predicted) |
| Density | 1.369±0.06 g/cm3(Predicted) |
| vapor pressure | 0.002-0.004Pa at 20-25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid:particulate/powder |
| color | White |
| InChI | InChI=1S/C5H8O4S2/c1-3-10(6,7)5-11(8,9)4-2/h3-4H,1-2,5H2 |
| InChIKey | IJHIIHORMWQZRQ-UHFFFAOYSA-N |
| SMILES | C(S(C=C)(=O)=O)S(C=C)(=O)=O |
| LogP | -0.6--0.5 at 19.8℃ and pH6.6 |
| CAS DataBase Reference | 3278-22-6(CAS DataBase Reference) |
| EPA Substance Registry System | Ethene, 1,1'-[methylenebis(sulfonyl)]bis- (3278-22-6) |
Description and Uses
Bis(vinylsulfonyl)methane (BVSM) can be used for:
(1) Medical gelatin scaffolds: as a cross-linking agent for biomacromolecules such as gelatin and proteins, to prevent the scaffold from degrading too rapidly within the body.
(2) Photographic materials: as a hardener for gelatin layers in the photographic film industry;
(3) Textile materials: for the modification of cellulose fibres, to enhance the crease resistance of fabrics or as a dye fixative.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341 |
| Precautionary statements | P201-P202-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P313-P405-P501 |
| TSCA | TSCA listed |
| HS Code | 2904.10.5000 |
| REACH Registrations | Active |







