A1449312
2-Bromobenzyl alcohol , ≥99.0%(GC) , 18982-54-2
CAS NO.：18982-54-2
Empirical Formula: C7H7BrO
Molecular Weight: 187.03
MDL number: MFCD00004600
EINECS: 242-719-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB28.80 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 50G | RMB95.20 | In Stock |
|
| 100G | RMB167.20 | In Stock |
|
| 250G | RMB375.20 | In Stock |
|
| 500G | RMB671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 220.79°C (rough estimate) |
| Density | 1.3839 (rough estimate) |
| refractive index | 1.5840 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 13.95±0.10(Predicted) |
| color | White |
| BRN | 2243418 |
| InChI | InChI=1S/C7H7BrO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 |
| InChIKey | IOWGHQGLUMEZKG-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC=C1Br |
| CAS DataBase Reference | 18982-54-2(CAS DataBase Reference) |
Description and Uses
2-Bromobenzyl alcohol was used in microwave assisted palladium-catalyzed synthesis of phthalides. It was also used in the synthesis of 1-hydroxy-3(1H)-l,2-benzoboroxole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 52/53-22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
