A1450512
2-Bromo-5-hydroxybenzaldehyde , 95% , 2973-80-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB174.40 | In Stock |
|
| 100G | RMB609.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-135 °C |
| Boiling point: | 286.7±20.0 °C(Predicted) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in chloroform, dichloromethane and ethyl acetate. |
| form | Solid |
| pka | 8.67±0.18(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H5BrO2/c8-7-2-1-6(10)3-5(7)4-9/h1-4,10H |
| InChIKey | SCRQAWQJSSKCFN-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=CC=C1Br |
| CAS DataBase Reference | 2973-80-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-hydroxybenzadehyde is a reactant used in the preparation of many pharmaceutical agents: Bcl-XL, PDE4 inhibitors, inhibitors of prostate cancer cell growth and anti-inflamatory agents.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H400 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50-22 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2909500090 |
