A1451412
Bromoethane-d5 , 99atom%D , 3675-63-6
Synonym(s):
Deuterated bromoethane;Ethyl-d5 bromide;Pentadeuteroethyl bromide
CAS NO.:3675-63-6
Empirical Formula: C2BrD5
Molecular Weight: 114
MDL number: MFCD00143876
EINECS: 222-944-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB799.20 | In Stock |
|
| 5G | RMB1778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -119 °C(lit.) |
| Boiling point: | 37-40 °C(lit.) |
| Density | 1.527 g/mL at 25 °C |
| vapor pressure | 7.96 psi ( 20 °C) |
| refractive index | n |
| Flash point: | −10 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile, Chloroform, DMSO (Soluble), Methanol (Sligthly) |
| form | Oil |
| color | Colourless |
| BRN | 1698455 |
| InChI | InChI=1S/C2H5Br/c1-2-3/h2H2,1H3/i1D3,2D2 |
| InChIKey | RDHPKYGYEGBMSE-ZBJDZAJPSA-N |
| SMILES | C([2H])([2H])(C([2H])([2H])[2H])Br |
| CAS DataBase Reference | 3675-63-6 |
| CAS Number Unlabeled | 74-96-4 |
Description and Uses
BROMOETHANE-D5, which is used in the synthesis of novel non-competitive antagonists of kainate Glu1/Glu2 receptors. It is used in the synthesis of tryptophan analogues.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H302-H351-H420 |
| Precautionary statements | P202-P210-P233-P301+P312-P308+P313-P502 |
| Hazard Codes | Xn,F |
| Risk Statements | 20/21/22-40-20/22-11 |
| Safety Statements | 28-36/37 |
| RIDADR | UN 1891 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-8-10 |
| HazardClass | 3, 6.1 |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Flam. Liq. 2 Ozone 1 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








