A1452212
2,5-Bis(trifluoromethyl)-3,6-dioxaundecafluorononanoyl Fluoride , ≥95.0%(GC) , 2641-34-1
CAS NO.:2641-34-1
Empirical Formula: C9F18O3
Molecular Weight: 498.07
MDL number: MFCD00054658
EINECS: 220-141-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5G | RMB245.60 | In Stock |
|
| 25g | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 113-115°C |
| Density | 1,8 g/cm3 |
| Flash point: | 71.1±22.2℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Sensitive | Moisture Sensitive |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C9F18O3/c10-1(28)2(11,5(15,16)17)29-9(26,27)4(14,7(21,22)23)30-8(24,25)3(12,13)6(18,19)20 |
| InChIKey | RZEXCUSSDZJJHD-UHFFFAOYSA-N |
| SMILES | C(F)(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 2641-34-1(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoyl fluoride, 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(heptafluoropropoxy)propoxy]- (2641-34-1) |
Description and Uses
Used in pharmaceutical synthesis and high-performance materials science.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| RTECS | UC3957000 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Toxicity | rat,LDLo,oral,60mg/kg (60mg/kg),National Technical Information Service. Vol. OTS0556053, |







