A1457312
3-Bromo-2-(bromomethyl)propionic Acid , ≥98.0%(T) , 41459-42-1
Synonym(s):
β,β′-Dibromoisobutyric acid
| Pack Size | Price | Stock | Quantity |
| 5G | RMB118.40 | In Stock |
|
| 10g | RMB256.80 | In Stock |
|
| 25G | RMB519.20 | In Stock |
|
| 100G | RMB1983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-101 °C(lit.) |
| Boiling point: | 286.7±30.0 °C(Predicted) |
| Density | 2.121±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in acetic acid. |
| form | Crystalline Powder |
| pka | 3.33±0.11(Predicted) |
| color | Off-white to brown |
| BRN | 1752505 |
| InChI | InChI=1S/C4H6Br2O2/c5-1-3(2-6)4(7)8/h3H,1-2H2,(H,7,8) |
| InChIKey | QQZJWQCLWOQDQV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(CBr)CBr |
| CAS DataBase Reference | 41459-42-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Propionic acid, 3-bromo-2-(bromomethyl)-(41459-42-1) |
Description and Uses
3-Bromo-2-(bromomethyl)propionic acid acts as an organic building block for the preparation of beta-substituted acrylates. It is used in the preparation of t-butyl 2-(phenylthiomethyl) propenoate, t-butyl 3-(phenylthio)-2-(phenylthiomethyl)propenoate and 3-(phenylthio)-2-(phenyl-sulfinylmethyl)propenoate. Further, it plays an important role in the synthesis of beta-lactams by cyclization of the corresponding amide.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 8 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
