A1457512
Brassicasterol , ≥97% , 474-67-9
Synonym(s):
24-Methyl cholest-5,22-dien-3β-ol;5,22-Cholestadien-24β-methyl-3β-ol
CAS NO.:474-67-9
Empirical Formula: C28H46O
Molecular Weight: 398.66
MDL number: MFCD00201659
EINECS: 207-486-5
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB1726.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-213℃ |
| Boiling point: | 488.7±14.0 °C(Predicted) |
| Density | 0.99±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 15.03±0.70(Predicted) |
| color | White to Off-White |
| biological source | semisynthetic |
| InChIKey | OILXMJHPFNGGTO-FFCHNKSWNA-N |
| SMILES | [C@@]12([H])CC[C@H]([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](O)CC3=CC[C@@]21[H] |&1:0,4,5,9,14,18,20,24,30,r| |
| LogP | 9.679 (est) |
Description and Uses
Brassicasterol was used as standard to analyze the sterols from mussels sample by thin layer chromatography.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H312-H302-H332-H319 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501 |
| WGK Germany | 3 |
| HS Code | 29061310 |




