A1458712
1,1-Bis(4-hydroxyphenyl)cyclohexane , ≥98.0%(GC) , 843-55-0
Synonym(s):
4,4′-Cyclohexylidenebisphenol;Bisphenol Z
CAS NO.:843-55-0
Empirical Formula: C18H20O2
Molecular Weight: 268.35
MDL number: MFCD00019341
EINECS: 212-677-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB27.20 | In Stock |
|
| 100G | RMB98.40 | In Stock |
|
| 250G | RMB231.20 | In Stock |
|
| 500G | RMB434.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-192 °C(lit.) |
| Boiling point: | 371.51°C (rough estimate) |
| Density | 1.0496 (rough estimate) |
| refractive index | 1.5490 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Practically insoluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.91±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C18H20O2/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15/h4-11,19-20H,1-3,12-13H2 |
| InChIKey | SDDLEVPIDBLVHC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)(C2=CC=C(O)C=C2)CCCCC1 |
| CAS DataBase Reference | 843-55-0(CAS DataBase Reference) |
Description and Uses
Bisphenol Z is one of the many derivatives of Bisphenol A (B519495) that can be used as HIF (hypoxia-inducible factor) inhibitors, antitumor agents, angiogenesis inhibitors, and antihypoxic agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





