PRODUCT Properties
| Melting point: | 49-52 °C (lit.) |
| Boiling point: | 98-100°C (0.5 torr) |
| Density | 1.7910 (estimate) |
| Flash point: | 127-128°C/2.4mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2692202 |
| InChI | InChI=1S/C6H4BrClO2S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H |
| InChIKey | VFPWGZNNRSQPBT-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1Br |
| CAS DataBase Reference | 2905-25-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromobenzenesulfonyl chloride(2905-25-1) |
Description and Uses
2-Bromobenzenesulfonyl chloride may be used in the following:
- Preparation of 2-bromobenzenesulfonic acid phenyl ester.
- For the sufonylation during the synthesis of 2-bromobenzenesulfonamide.
- Synthesis of chiral 2-(p-toluenesulfinyl)benzenesulfonamide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




