A1465412
Bis(2-pyridylmethyl)amine , ≥98.0%(T) , 1539-42-0
Synonym(s):
Bis(2-pyridylmethyl)amine
CAS NO.:1539-42-0
Empirical Formula: C12H13N3
Molecular Weight: 199.25
MDL number: MFCD00129044
EINECS: 216-266-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB494.40 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 139-141 °C/1 mmHg (lit.) |
| Density | 1.107 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | water: soluble (partially miscible)(lit.) |
| pka | 5.89±0.20(Predicted) |
| form | clear liquid |
| color | White to Yellow to Green |
| Water Solubility | water: soluble (partially miscible)(lit.) |
| InChI | InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2 |
| InChIKey | KXZQYLBVMZGIKC-UHFFFAOYSA-N |
| SMILES | C1(CNCC2=NC=CC=C2)=NC=CC=C1 |
| EPA Substance Registry System | 2,2'-Dipicolylamine (1539-42-0) |
Description and Uses
2,2'-Dipicolylamine is a metal chelators and a potential MBL inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







