A1466412
2-Aminobenzoxazole , 97% , 4570-41-6
Synonym(s):
2-Benzoxazolamine;Benzooxazol-2-ylamine
CAS NO.:4570-41-6
Empirical Formula: C7H6N2O
Molecular Weight: 134.14
MDL number: MFCD00182850
EINECS: 224-952-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5g | RMB136.00 | In Stock |
|
| 25G | RMB409.60 | In Stock |
|
| 100g | RMB1561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-133℃ |
| Boiling point: | 247.23°C (rough estimate) |
| Density | 1.2296 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 2.75±0.10(Predicted) |
| form | Solid |
| color | Off-White to Light Brown |
| BRN | 115981 |
| InChI | InChI=1S/C7H6N2O/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H2,8,9) |
| InChIKey | JPBLHOJFMBOCAF-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2N=C1N |
Description and Uses
2-Aminobenzoxazole and its isothiocyanate derivatives are used as antihelminthic agents, and its fluorescence properties make it of use in the dye industry. It is also used as a reagent to synthesize N-benzothiazolyl-2-arylacetamide derivatives, Protein Kinase 1 inhibitors that can be used to treat amyotrophic lateral sclerosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38-52 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DM4500000 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![(S)-N-(2-Amino-4,5,6,7-tetrahydrobenzo[d]thiazol-6-yl)propionamide](https://img.chemicalbook.com/CAS/GIF/106006-84-2.gif)

