A1466612
Bis(4-nitrophenyl) Carbonate , ≥97.0%(HPLC) , 5070-13-3
Synonym(s):
4-Nitrophenyl carbonate
CAS NO.：5070-13-3
Empirical Formula: C13H8N2O7
Molecular Weight: 304.21
MDL number: MFCD00007322
EINECS: 225-775-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB90.40 | In Stock |
|
| 100G | RMB270.40 | In Stock |
|
| 500g | RMB1128.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-139 °C(lit.) |
| Boiling point: | 475.9±30.0 °C(Predicted) |
| Density | 1.501±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform and tetrahydrofuran. |
| form | Liquid |
| color | Clear slightly yellow or greenish to brown |
| Sensitive | Moisture Sensitive |
| BRN | 1892897 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H8N2O7/c16-13(21-11-5-1-9(2-6-11)14(17)18)22-12-7-3-10(4-8-12)15(19)20/h1-8H |
| InChIKey | ACBQROXDOHKANW-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)OC1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 5070-13-3(CAS DataBase Reference) |
Description and Uses
Bis(4-nitrophenyl) Carbonate is used a peptide coupling reagent and reagent for formation of carbamate linked cytosines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
