A1468612
Boc-3-Abz-OH , ≥97.0% , 111331-82-9
Synonym(s):
3-(Boc-amino)benzoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195 °C (dec.) |
| Boiling point: | 339.8±25.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.15±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 5813611 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H15NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h4-7H,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | SAPAUOFSCLCQJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(c1)C(O)=O |
| CAS DataBase Reference | 111331-82-9(CAS DataBase Reference) |
Description and Uses
Boc-3-Abz-OH, is an intermediate in the synthesis of various pharmaceutical compounds, including inhibitors, and therapeutic agents. It can also be used in the preparation of conformationally-constrained cyclic peptides with biarylamine linkers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H302-H312 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







