A1470650
1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine , 98% , 253168-94-4
CAS NO.：253168-94-4
Empirical Formula: C12H19NO4S
Molecular Weight: 273.35
MDL number: MFCD27665207
EINECS: 807-312-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB133.60 | In Stock |
|
| 25g | RMB341.60 | In Stock |
|
| 100g | RMB836.00 | In Stock |
|
| 500g | RMB2397.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120 °C |
| Boiling point: | 469.6±45.0 °C(Predicted) |
| Density | 1.195±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Slightly, Heated), Methanol (Slightly) |
| pka | 6.84±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C12H19NO4S/c1-4-17-12-7-9(5-6-11(12)16-2)10(13)8-18(3,14)15/h5-7,10H,4,8,13H2,1-3H3 |
| InChIKey | BXUJVINGXQGNFD-UHFFFAOYSA-N |
| SMILES | C1(C(CS(C)(=O)=O)N)=CC=C(OC)C(OCC)=C1 |
Description and Uses
1-(3-Ethoxy-4-methoxy-phenyl)-2-methanesulfonylethylamine is used in the enantioselective synthesis of Apremilast (A729700) aminosulfone using catalytic asymetric hydrogenation. Apremilast EP Impurity H
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| HS Code | 2922.50.4000 |
