A1471112
3-Bromo-2-hydroxy-5-nitropyridine , ≥97% , 15862-33-6
Synonym(s):
3-Bromo-5-nitro-2-pyridinol
CAS NO.:15862-33-6
Empirical Formula: C5H3BrN2O3
Molecular Weight: 218.99
MDL number: MFCD03840431
EINECS: 640-197-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB357.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-218℃ |
| Boiling point: | 300.9±42.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 6.58±0.10(Predicted) |
| form | Solid |
| color | White to Light yellow |
| InChI | InChI=1S/C5H3BrN2O3/c6-4-1-3(8(10)11)2-7-5(4)9/h1-2H,(H,7,9) |
| InChIKey | KWSOHRDMTWDAOI-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C([N+]([O-])=O)C=C1Br |
Description and Uses
3-Bromo-2-hydroxy-5-nitropyridine is used widely in fields such as medicine, agricultural chemicals and organic syntheses.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





