A1472512
3-(Boc-amino)azetidine hydrochloride , ≥97% , 217806-26-3
CAS NO.：217806-26-3
Empirical Formula: C8H16N2O2.HCl
Molecular Weight: 208.69
MDL number: MFCD09839423
EINECS: 817-563-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 500mg | RMB31.20 | In Stock |
|
| 1G | RMB52.00 | In Stock |
|
| 5g | RMB169.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175° |
| Boiling point: | 303℃ |
| Flash point: | 137°(279°F) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H16N2O2.ClH/c1-8(2,3)12-7(11)10-6-4-9-5-6;/h6,9H,4-5H2,1-3H3,(H,10,11);1H |
| InChIKey | VLOLOLUAVFGUTD-UHFFFAOYSA-N |
| SMILES | O(C(=O)NC1CNC1)C(C)(C)C.Cl |
| CAS DataBase Reference | 217806-26-3 |
Description and Uses
tert-Butyl (azetidin-3-yl)carbamate hydrochloride is an organic salt compound containing an amino functional group, which can be used to synthesize tert-butyl (1-(5-(hydroxymethyl)pyrimidin-2-yl)azetidin-3-yl)carbamate by reacting with (2-Chloropyrimidin-5-yl)methanol.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H411 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P273 |
| Risk Statements | 52 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
