A1473312
1,3-Bis-(2,6-diisopropylphenyl)imidazolinium chloride , 97% , 258278-25-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 500MG | RMB59.20 | In Stock |
|
| 1G | RMB177.60 | In Stock |
|
| 5G | RMB582.40 | In Stock |
|
| 25G | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289-293 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | White to yellow |
| Sensitive | air sensitive |
| InChI | InChI=1S/C27H40N2.ClH/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;/h9-14,18-21H,15-17H2,1-8H3;1H |
| InChIKey | LWPXTYZKAWSRIP-UHFFFAOYSA-M |
| SMILES | N1(CCN(C2=C(C=CC=C2C(C)C)C(C)C)C1)C1C(=CC=CC=1C(C)C)C(C)C.Cl |
| CAS DataBase Reference | 258278-25-0 |
Description and Uses
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






