A1476612
5-Bromo-2-methoxypyridine-3-carboxylic acid , ≥97% , 54916-66-4
Synonym(s):
5-Bromo-2-methoxynicotinic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25g | RMB541.60 | In Stock |
|
| 100g | RMB2040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158 |
| Boiling point: | 324.8±42.0 °C(Predicted) |
| Density | 1.713 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | 2.97±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C7H6BrNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3H,1H3,(H,10,11) |
| InChIKey | SJLXURQPRRMPIV-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C(Br)C=C1C(O)=O |
| CAS DataBase Reference | 54916-66-4(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-methoxy-nicotinic acid is used as an intermediate in pharmaceutical synthesis and can be employed to prepare RXFP1 receptor agonists. Its synthetic products can selectively activate the RXFP1 receptor for the treatment of heart failure, with an EC50 value of approximately 6.3nM.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | nwg |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
![5-bromo-2-methylimidazo[1,2-a]pyridine](https://img.chemicalbook.com/CAS/GIF/74420-51-2.gif)
