A1477512
4-Bromo-4'-propylbiphenyl , ≥98.0%(GC) , 58743-81-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB260.00 | In Stock |
|
| 100G | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109°C |
| Boiling point: | 349.5±21.0 °C(Predicted) |
| Density | 1.249±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C15H15Br/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h4-11H,2-3H2,1H3 |
| InChIKey | DPERLOMMOVDOHH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCC)C=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 58743-81-0(CAS DataBase Reference) |
Description and Uses
4-BROMO-4'-PROPYLBIPHENYL is an intermediate used in the synthesis of a series of cyanobiphenyls which are liquid crystal materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2903.99.8001 |



