PRODUCT Properties
| Melting point: | 96-103℃ |
| Boiling point: | 235.3±20.0℃ (760 Torr) |
| Density | 1.844±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 96.1±21.8℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 7.91±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C6H5BrO2/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H |
| InChIKey | UOLPZAPIFFZLMF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(O)=C1Br |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2908190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






