A1487212
Boc-Cys-OH , ≥95% , 20887-95-0
Synonym(s):
Boc-L -cysteine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB108.00 | In Stock |
|
| 1G | RMB248.00 | In Stock |
|
| 5g | RMB782.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70°C |
| Boiling point: | 361.4±37.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol |
| pka | 3.57±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +8.0±1.5°, c = 1% in ethanol |
| BRN | 2450705 |
| InChI | InChI=1S/C8H15NO4S/c1-8(2,3)13-7(12)9-5(4-14)6(10)11/h5,14H,4H2,1-3H3,(H,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | ATVFTGTXIUDKIZ-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CS)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 20887-95-0(CAS DataBase Reference) |
Description and Uses
Boc-L-cysteine is the protected form of L-Cysteine (C995000), a non-essential α-amino acid that is biosynthesized in humans. L-Cysteine is also a bicarbonate-sensitive endogenous excitotoxin in rats and possibly humans.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H319-H413-H372 |
| Precautionary statements | P501-P273-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |









