PRODUCT Properties
| Melting point: | 63-67 °C |
| Boiling point: | 160°C/0.1mmHg(lit.) |
| Density | 1.233 |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C14H10O3/c15-9-11-1-5-13(6-2-11)17-14-7-3-12(10-16)4-8-14/h1-10H |
| InChIKey | GXZZHLULZRMUQC-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(Oc2ccc(cc2)C([H])=O)cc1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 2 |
| HS Code | 2912490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |