A1499112
5-Bromo-2-chlorobenzaldehyde , >98.0%(GC) , 189628-37-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB153.60 | In Stock |
|
| 100G | RMB419.20 | In Stock |
|
| 500G | RMB1983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-46℃ |
| Boiling point: | 261℃ |
| Density | 1.698 |
| Flash point: | 112℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), DMSO (Soluble, Heated), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | Off-white to pale yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H4BrClO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
| InChIKey | DPKKRQAEYWOISP-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Br)=CC=C1Cl |
Description and Uses
It finds its application as an intermediate in organic syntheses.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,E |
| HS Code | 2913000090 |
| REACH Registrations | Active |







