A1500212
Benzyl Acrylate (stabilized with MEHQ) , >97.0%(GC) , 2495-35-4
Synonym(s):
Acrylic acid benzyl ester
CAS NO.:2495-35-4
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00048147
EINECS: 219-673-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB41.60 | In Stock |
|
| 10g | RMB60.00 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 50g | RMB244.00 | In Stock |
|
| 100G | RMB382.40 | In Stock |
|
| 250g | RMB863.20 | In Stock |
|
| 500G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-216 °C |
| Boiling point: | 110-111°C 8mm |
| Density | 1,08 g/cm3 |
| vapor pressure | 11.2Pa at 25℃ |
| refractive index | 1.5180 |
| Flash point: | 111°C/8mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Water Solubility | Miscible with organic solvents and water. |
| InChI | InChI=1S/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)C=C |
| LogP | 2.436 |
| CAS DataBase Reference | 2495-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyl acrylate (2495-35-4) |
Description and Uses
Preparation of high refractive index polyacrylates.Benzyl acrylate is used in the preparation of heptanoic acid benzyl ester. It is used to prepare polybenzylacrylate using azobisisobutyronitrile as initiator.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H335-H411 |
| Precautionary statements | P261-P264-P271-P273-P280-P302+P352 |
| target organs | Respiratory system |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-61-28 |
| RIDADR | UN3082 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






