A1501412
1-Benzoyl-4-piperidone , >97.0%(GC) , 24686-78-0
CAS NO.:24686-78-0
Empirical Formula: C12H13NO2
Molecular Weight: 203.24
MDL number: MFCD00006189
EINECS: 246-407-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB277.60 | In Stock |
|
| 100G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C (lit.) |
| Boiling point: | 158-160 °C/0.2 mmHg (lit.) |
| Density | 1.1255 (rough estimate) |
| refractive index | 1.5440 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methylene chloride: soluble |
| pka | -1.45±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 158848 |
| InChI | 1S/C12H13NO2/c14-11-6-8-13(9-7-11)12(15)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | NZAXGZYPZGEVBD-UHFFFAOYSA-N |
| SMILES | O=C1CCN(CC1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 24686-78-0(CAS DataBase Reference) |
Description and Uses
1-Benzoyl-4-piperidone can be used as starting reagent in the synthesis of fentanyl.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P312-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29333999 |
| Storage Class | 13 - Non Combustible Solids |







