A1503612
2-Bromophenacyl Bromide , >97.0% , 49851-55-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB283.20 | In Stock |
|
| 5G | RMB991.20 | In Stock |
|
| 25g | RMB3470.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 90-92°C/0.02mm |
| Density | 1.848±0.06 g/cm3(Predicted) |
| refractive index | 1.6100-1.6140 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H6Br2O/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4H,5H2 |
| InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1Br)CBr |
Description and Uses
2,2''-Dibromoacetophenone is used in the preparation of 4-phenylthiazol-2(3H)-one derivatives as anticonvulsant agents.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| RIDADR | 3261 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2914790090 |
