A1515912
1-Benzyl-4-hydroxypiperidine , 98% , 4727-72-4
Synonym(s):
1-Benzyl-4-piperidinol
CAS NO.:4727-72-4
Empirical Formula: C12H17NO
Molecular Weight: 191.27
MDL number: MFCD00006503
EINECS: 225-226-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB154.40 | In Stock |
|
| 500g | RMB754.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-63 °C(lit.) |
| Boiling point: | 127-128 °C2 mm Hg(lit.) |
| Density | 1.0096 (rough estimate) |
| refractive index | 1.5212 (estimate) |
| Flash point: | 121-123°C/0.7mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | 14.87±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| Sensitive | Hygroscopic |
| BRN | 146118 |
| InChI | InChI=1S/C12H17NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2 |
| InChIKey | BPPZXJZYCOETDA-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(O)CC1 |
| CAS DataBase Reference | 4727-72-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Piperidinol, 1-(phenylmethyl)-(4727-72-4) |
Description and Uses
1-Benzyl-4-hydroxypiperidine was used as an alternative molecule to study the ligand concentration attached to the epoxy-activated Sepharose 6B.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,C,Xi,Xn |
| Risk Statements | 25-36/37/38-20/21/22 |
| Safety Statements | 26-45-37/39-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





