A1517412
Bis(2-ethylhexyl) Isophthalate , >98.0%(GC) , 137-89-3
Synonym(s):
1,3-Benzenedicarboxylic acid 1,3-bis(2-ethylhexyl) ester;Di-2-ethylhexyl isophthalate;DOIP;Isophthalic acid bis(2-ethylhexyl ester)
CAS NO.：137-89-3
Empirical Formula: C24H38O4
Molecular Weight: 390.56
MDL number: MFCD00152284
EINECS: 205-308-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB55.20 | In Stock |
|
| 100g | RMB127.20 | In Stock |
|
| 500G | RMB216.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -46 |
| Boiling point: | 211°C/2mmHg(lit.) |
| Density | 1.0101 (rough estimate) |
| refractive index | 1.4860 to 1.4900 |
| Flash point: | 233°C(lit.) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| Water Solubility | 11ug/L(24 ºC) |
| BRN | 2162836 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C24H38O4/c1-5-9-12-19(7-3)17-27-23(25)21-14-11-15-22(16-21)24(26)28-18-20(8-4)13-10-6-2/h11,14-16,19-20H,5-10,12-13,17-18H2,1-4H3 |
| InChIKey | WXZOXVVKILCOPG-UHFFFAOYSA-N |
| SMILES | O(CC(CCCC)CC)C(=O)c1cc(ccc1)C(=O)OCC(CCCC)CC |
| EPA Substance Registry System | Bis(2-ethylhexyl) isophthalate (137-89-3) |
Description and Uses
Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360FD-H400 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | T,N |
| Risk Statements | 60-61-50 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | NT2050000 |
| TSCA | TSCA listed |
| HS Code | 2917.39.7000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Repr. 1B |
