A1519312
5-Bromo-2-hydroxypyridine , ≥98.0% , 13466-38-1
CAS NO.:13466-38-1
Empirical Formula: C5H4BrNO
Molecular Weight: 174
MDL number: MFCD00234042
EINECS: 629-311-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-183 °C(lit.) |
| Boiling point: | 305.9±42.0 °C(Predicted) |
| Density | 1.776±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 9.96±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to yellow-brown |
| BRN | 108751 |
| InChI | InChI=1S/C5H4BrNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
| InChIKey | NDMZZQRNZFWMEZ-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(Br)C=C1 |
| CAS DataBase Reference | 13466-38-1(CAS DataBase Reference) |
Description and Uses
5-Bromopyridin-2-ol is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






